C34H34N2O — CID 153428756
3-[3-tert-butyl-5-[3-(4-tert-butyl-2-pyridinyl)phenoxy]phenyl]isoquinoline (PubChem CID 153428756) has the molecular formula C34H34N2O and a molecular weight of 486.66 g/mol. Its IUPAC name is 3-[3-tert-butyl-5-[3-(4-tert-butyl-2-pyridinyl)phenoxy]phenyl]isoquinoline.
| Compound Name | 3-[3-tert-butyl-5-[3-(4-tert-butyl-2-pyridinyl)phenoxy]phenyl]isoquinoline |
|---|---|
| PubChem CID | 153428756 |
| Molecular Formula | C34H34N2O |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 3-[3-tert-butyl-5-[3-(4-tert-butyl-2-pyridinyl)phenoxy]phenyl]isoquinoline |
| SMILES | CC(C)(C)c1cc(Oc2cccc(-c3cc(C(C)(C)C)ccn3)c2)cc(-c2cc3ccccc3cn2)c1 |
| InChI | InChI=1S/C34H34N2O/c1-33(2,3)27-14-15-35-32(21-27)24-12-9-13-29(17-24)37-30-18-26(16-28(20-30)34(4,5)6)31-19-23-10-7-8-11-25(23)22-36-31/h7-22H,1-6H3 |
| InChIKey | DNBMDUMMHKXWHT-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |