C37H42N2OSi — CID 177122707
[2-(4-tert-butylnaphthalen-2-yl)-6-[3-(4-tert-butyl-2-pyridinyl)phenoxy]-4-pyridinyl]-trimethylsilane (PubChem CID 177122707) has the molecular formula C37H42N2OSi and a molecular weight of 558.84 g/mol. Its IUPAC name is [2-(4-tert-butylnaphthalen-2-yl)-6-[3-(4-tert-butyl-2-pyridinyl)phenoxy]-4-pyridinyl]-trimethylsilane.
| Compound Name | [2-(4-tert-butylnaphthalen-2-yl)-6-[3-(4-tert-butyl-2-pyridinyl)phenoxy]-4-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 177122707 |
| Molecular Formula | C37H42N2OSi |
| Molecular Weight | 558.84 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | [2-(4-tert-butylnaphthalen-2-yl)-6-[3-(4-tert-butyl-2-pyridinyl)phenoxy]-4-pyridinyl]-trimethylsilane |
| SMILES | CC(C)(C)c1ccnc(-c2cccc(Oc3cc([Si](C)(C)C)cc(-c4cc(C(C)(C)C)c5ccccc5c4)n3)c2)c1 |
| InChI | InChI=1S/C37H42N2OSi/c1-36(2,3)28-17-18-38-33(22-28)26-14-12-15-29(20-26)40-35-24-30(41(7,8)9)23-34(39-35)27-19-25-13-10-11-16-31(25)32(21-27)37(4,5)6/h10-24H,1-9H3 |
| InChIKey | CKDGRZMNJVHCES-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.84 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|