C30H32N2 — CID 170196288
4-tert-butyl-2-[3-(4-tert-butyl-2-pyridinyl)phenyl]-6-phenylpyridine (PubChem CID 170196288) has the molecular formula C30H32N2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 4-tert-butyl-2-[3-(4-tert-butyl-2-pyridinyl)phenyl]-6-phenylpyridine.
| Compound Name | 4-tert-butyl-2-[3-(4-tert-butyl-2-pyridinyl)phenyl]-6-phenylpyridine |
|---|---|
| PubChem CID | 170196288 |
| Molecular Formula | C30H32N2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 4-tert-butyl-2-[3-(4-tert-butyl-2-pyridinyl)phenyl]-6-phenylpyridine |
| SMILES | CC(C)(C)c1ccnc(-c2cccc(-c3cc(C(C)(C)C)cc(-c4ccccc4)n3)c2)c1 |
| InChI | InChI=1S/C30H32N2/c1-29(2,3)24-15-16-31-26(18-24)22-13-10-14-23(17-22)28-20-25(30(4,5)6)19-27(32-28)21-11-8-7-9-12-21/h7-20H,1-6H3 |
| InChIKey | XOIWCGAGHJTTKZ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |