C39H34N2O — CID 167252790
2-[3-(4-tert-butyl-2-pyridinyl)phenyl]-6-(2-methoxyphenyl)-4-(2-phenylphenyl)pyridine (PubChem CID 167252790) has the molecular formula C39H34N2O and a molecular weight of 546.71 g/mol. Its IUPAC name is 2-[3-(4-tert-butyl-2-pyridinyl)phenyl]-6-(2-methoxyphenyl)-4-(2-phenylphenyl)pyridine.
| Compound Name | 2-[3-(4-tert-butyl-2-pyridinyl)phenyl]-6-(2-methoxyphenyl)-4-(2-phenylphenyl)pyridine |
|---|---|
| PubChem CID | 167252790 |
| Molecular Formula | C39H34N2O |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | 2-[3-(4-tert-butyl-2-pyridinyl)phenyl]-6-(2-methoxyphenyl)-4-(2-phenylphenyl)pyridine |
| SMILES | COc1ccccc1-c1cc(-c2ccccc2-c2ccccc2)cc(-c2cccc(-c3cc(C(C)(C)C)ccn3)c2)n1 |
| InChI | InChI=1S/C39H34N2O/c1-39(2,3)31-21-22-40-35(26-31)28-15-12-16-29(23-28)36-24-30(25-37(41-36)34-19-10-11-20-38(34)42-4)33-18-9-8-17-32(33)27-13-6-5-7-14-27/h5-26H,1-4H3 |
| InChIKey | RQUKXZSWMSBACP-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |