C40H33N3O — CID 167253461
2-[6-[3-(4-tert-butyl-2-pyridinyl)phenyl]-4-(2-indol-1-ylphenyl)-2-pyridinyl]phenol (PubChem CID 167253461) has the molecular formula C40H33N3O and a molecular weight of 571.72 g/mol. Its IUPAC name is 2-[6-[3-(4-tert-butyl-2-pyridinyl)phenyl]-4-(2-indol-1-ylphenyl)-2-pyridinyl]phenol.
| Compound Name | 2-[6-[3-(4-tert-butyl-2-pyridinyl)phenyl]-4-(2-indol-1-ylphenyl)-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 167253461 |
| Molecular Formula | C40H33N3O |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | 2-[6-[3-(4-tert-butyl-2-pyridinyl)phenyl]-4-(2-indol-1-ylphenyl)-2-pyridinyl]phenol |
| SMILES | CC(C)(C)c1ccnc(-c2cccc(-c3cc(-c4ccccc4-n4ccc5ccccc54)cc(-c4ccccc4O)n3)c2)c1 |
| InChI | InChI=1S/C40H33N3O/c1-40(2,3)31-19-21-41-34(26-31)28-12-10-13-29(23-28)35-24-30(25-36(42-35)33-15-6-9-18-39(33)44)32-14-5-8-17-38(32)43-22-20-27-11-4-7-16-37(27)43/h4-26,44H,1-3H3 |
| InChIKey | JXSIRUATCZDNEU-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |