C36H31N3 — CID 171751604
5-[3-(4-tert-butyl-2-pyridinyl)phenyl]-8-(2-methyl-3-phenylphenyl)quinoxaline (PubChem CID 171751604) has the molecular formula C36H31N3 and a molecular weight of 505.67 g/mol. Its IUPAC name is 5-[3-(4-tert-butyl-2-pyridinyl)phenyl]-8-(2-methyl-3-phenylphenyl)quinoxaline.
| Compound Name | 5-[3-(4-tert-butyl-2-pyridinyl)phenyl]-8-(2-methyl-3-phenylphenyl)quinoxaline |
|---|---|
| PubChem CID | 171751604 |
| Molecular Formula | C36H31N3 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 5-[3-(4-tert-butyl-2-pyridinyl)phenyl]-8-(2-methyl-3-phenylphenyl)quinoxaline |
| SMILES | Cc1c(-c2ccccc2)cccc1-c1ccc(-c2cccc(-c3cc(C(C)(C)C)ccn3)c2)c2nccnc12 |
| InChI | InChI=1S/C36H31N3/c1-24-29(25-10-6-5-7-11-25)14-9-15-30(24)32-17-16-31(34-35(32)39-21-20-38-34)26-12-8-13-27(22-26)33-23-28(18-19-37-33)36(2,3)4/h5-23H,1-4H3 |
| InChIKey | UKBPCMHBMXRWSA-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |