C34H34N2 — CID 171751639
5-(3-tert-butylphenyl)-8-[3-(4-tert-butyl-2-pyridinyl)phenyl]quinoline (PubChem CID 171751639) has the molecular formula C34H34N2 and a molecular weight of 470.66 g/mol. Its IUPAC name is 5-(3-tert-butylphenyl)-8-[3-(4-tert-butyl-2-pyridinyl)phenyl]quinoline.
| Compound Name | 5-(3-tert-butylphenyl)-8-[3-(4-tert-butyl-2-pyridinyl)phenyl]quinoline |
|---|---|
| PubChem CID | 171751639 |
| Molecular Formula | C34H34N2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 5-(3-tert-butylphenyl)-8-[3-(4-tert-butyl-2-pyridinyl)phenyl]quinoline |
| SMILES | CC(C)(C)c1cccc(-c2ccc(-c3cccc(-c4cc(C(C)(C)C)ccn4)c3)c3ncccc23)c1 |
| InChI | InChI=1S/C34H34N2/c1-33(2,3)26-13-8-11-24(21-26)28-15-16-29(32-30(28)14-9-18-36-32)23-10-7-12-25(20-23)31-22-27(17-19-35-31)34(4,5)6/h7-22H,1-6H3 |
| InChIKey | ITYYFQVQLUQNAF-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |