C33H33N3O — CID 153428997
8-(4-tert-butyl-2-pyridinyl)-6-[3-(4-tert-butyl-2-pyridinyl)phenoxy]quinoline (PubChem CID 153428997) has the molecular formula C33H33N3O and a molecular weight of 487.65 g/mol. Its IUPAC name is 8-(4-tert-butyl-2-pyridinyl)-6-[3-(4-tert-butyl-2-pyridinyl)phenoxy]quinoline.
| Compound Name | 8-(4-tert-butyl-2-pyridinyl)-6-[3-(4-tert-butyl-2-pyridinyl)phenoxy]quinoline |
|---|---|
| PubChem CID | 153428997 |
| Molecular Formula | C33H33N3O |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 8-(4-tert-butyl-2-pyridinyl)-6-[3-(4-tert-butyl-2-pyridinyl)phenoxy]quinoline |
| SMILES | CC(C)(C)c1ccnc(-c2cccc(Oc3cc(-c4cc(C(C)(C)C)ccn4)c4ncccc4c3)c2)c1 |
| InChI | InChI=1S/C33H33N3O/c1-32(2,3)24-12-15-34-29(19-24)22-9-7-11-26(17-22)37-27-18-23-10-8-14-36-31(23)28(21-27)30-20-25(13-16-35-30)33(4,5)6/h7-21H,1-6H3 |
| InChIKey | QYJKWWASEYOOJN-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |