C37H33N3O2+2 — CID 168758281
2-[3-tert-butyl-5-[3-(3-methylimidazole-1,3-diium-1-yl)phenoxy]phenyl]-4-(3-phenoxyphenyl)pyridine (PubChem CID 168758281) has the molecular formula C37H33N3O2+2 and a molecular weight of 551.69 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-[3-(3-methylimidazole-1,3-diium-1-yl)phenoxy]phenyl]-4-(3-phenoxyphenyl)pyridine.
| Compound Name | 2-[3-tert-butyl-5-[3-(3-methylimidazole-1,3-diium-1-yl)phenoxy]phenyl]-4-(3-phenoxyphenyl)pyridine |
|---|---|
| PubChem CID | 168758281 |
| Molecular Formula | C37H33N3O2+2 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 2-[3-tert-butyl-5-[3-(3-methylimidazole-1,3-diium-1-yl)phenoxy]phenyl]-4-(3-phenoxyphenyl)pyridine |
| SMILES | C[N+]1=C=[N+](c2cccc(Oc3cc(-c4cc(-c5cccc(Oc6ccccc6)c5)ccn4)cc(C(C)(C)C)c3)c2)C=C1 |
| InChI | InChI=1S/C37H33N3O2/c1-37(2,3)30-20-29(22-35(24-30)42-34-15-9-11-31(25-34)40-19-18-39(4)26-40)36-23-28(16-17-38-36)27-10-8-14-33(21-27)41-32-12-6-5-7-13-32/h5-25H,1-4H3/q+2 |
| InChIKey | HTORVQJOOAHYEE-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 37.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|