C35H30N4O2+2 — CID 168758393
N,N-dimethyl-3-(3-methylimidazole-1,3-diium-1-yl)-5-[3-[4-(3-phenoxyphenyl)-2-pyridinyl]phenoxy]aniline (PubChem CID 168758393) has the molecular formula C35H30N4O2+2 and a molecular weight of 538.65 g/mol. Its IUPAC name is N,N-dimethyl-3-(3-methylimidazole-1,3-diium-1-yl)-5-[3-[4-(3-phenoxyphenyl)-2-pyridinyl]phenoxy]aniline.
| Compound Name | N,N-dimethyl-3-(3-methylimidazole-1,3-diium-1-yl)-5-[3-[4-(3-phenoxyphenyl)-2-pyridinyl]phenoxy]aniline |
|---|---|
| PubChem CID | 168758393 |
| Molecular Formula | C35H30N4O2+2 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | N,N-dimethyl-3-(3-methylimidazole-1,3-diium-1-yl)-5-[3-[4-(3-phenoxyphenyl)-2-pyridinyl]phenoxy]aniline |
| SMILES | CN(C)c1cc(Oc2cccc(-c3cc(-c4cccc(Oc5ccccc5)c4)ccn3)c2)cc([N+]2=C=[N+](C)C=C2)c1 |
| InChI | InChI=1S/C35H30N4O2/c1-37(2)29-22-30(39-18-17-38(3)25-39)24-34(23-29)41-33-14-8-10-28(20-33)35-21-27(15-16-36-35)26-9-7-13-32(19-26)40-31-11-5-4-6-12-31/h4-24H,1-3H3/q+2 |
| InChIKey | KINPCXIRUQRKQP-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 40.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|