C33H25N3O2+2 — CID 168758183
2-[3-[3-(3-methylimidazole-1,3-diium-1-yl)phenoxy]phenyl]-4-(3-phenoxyphenyl)pyridine (PubChem CID 168758183) has the molecular formula C33H25N3O2+2 and a molecular weight of 495.58 g/mol. Its IUPAC name is 2-[3-[3-(3-methylimidazole-1,3-diium-1-yl)phenoxy]phenyl]-4-(3-phenoxyphenyl)pyridine.
| Compound Name | 2-[3-[3-(3-methylimidazole-1,3-diium-1-yl)phenoxy]phenyl]-4-(3-phenoxyphenyl)pyridine |
|---|---|
| PubChem CID | 168758183 |
| Molecular Formula | C33H25N3O2+2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 2-[3-[3-(3-methylimidazole-1,3-diium-1-yl)phenoxy]phenyl]-4-(3-phenoxyphenyl)pyridine |
| SMILES | C[N+]1=C=[N+](c2cccc(Oc3cccc(-c4cc(-c5cccc(Oc6ccccc6)c5)ccn4)c3)c2)C=C1 |
| InChI | InChI=1S/C33H25N3O2/c1-35-18-19-36(24-35)28-10-7-15-32(23-28)38-31-14-6-9-27(21-31)33-22-26(16-17-34-33)25-8-5-13-30(20-25)37-29-11-3-2-4-12-29/h2-23H,1H3/q+2 |
| InChIKey | OTPPVWPAIVWUBX-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 37.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|