C45H47N2OSb — CID 164733553
[2-[3-tert-butyl-5-[3-tert-butyl-5-(4-propan-2-yl-2-pyridinyl)phenoxy]phenyl]-4-pyridinyl]-diphenylstibane (PubChem CID 164733553) has the molecular formula C45H47N2OSb and a molecular weight of 753.64 g/mol. Its IUPAC name is [2-[3-tert-butyl-5-[3-tert-butyl-5-(4-propan-2-yl-2-pyridinyl)phenoxy]phenyl]-4-pyridinyl]-diphenylstibane.
| Compound Name | [2-[3-tert-butyl-5-[3-tert-butyl-5-(4-propan-2-yl-2-pyridinyl)phenoxy]phenyl]-4-pyridinyl]-diphenylstibane |
|---|---|
| PubChem CID | 164733553 |
| Molecular Formula | C45H47N2OSb |
| Molecular Weight | 753.64 g/mol |
| Exact Mass | 752.27 |
| IUPAC Name | [2-[3-tert-butyl-5-[3-tert-butyl-5-(4-propan-2-yl-2-pyridinyl)phenoxy]phenyl]-4-pyridinyl]-diphenylstibane |
| SMILES | CC(C)c1ccnc(-c2cc(Oc3cc(-c4cc([Sb](c5ccccc5)c5ccccc5)ccn4)cc(C(C)(C)C)c3)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C33H37N2O.2C6H5.Sb/c1-22(2)23-12-14-35-31(19-23)25-16-27(33(6,7)8)21-29(18-25)36-28-17-24(30-11-9-10-13-34-30)15-26(20-28)32(3,4)5;2*1-2-4-6-5-3-1;/h10-22H,1-8H3;2*1-5H; |
| InChIKey | YHVWQDUUJZSBPA-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.64 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|