C40H34N3O2+ — CID 162494110
4-(3-tert-butyl-5-isoquinolin-1-ylphenoxy)-12,12-dimethyl-3-aza-11-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2(11),3,5,7,9,13,15,17(21),18-decaen-20-ol (PubChem CID 162494110) has the molecular formula C40H34N3O2+ and a molecular weight of 588.73 g/mol. Its IUPAC name is 4-(3-tert-butyl-5-isoquinolin-1-ylphenoxy)-12,12-dimethyl-3-aza-11-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2(11),3,5,7,9,13,15,17(21),18-decaen-20-ol.
| Compound Name | 4-(3-tert-butyl-5-isoquinolin-1-ylphenoxy)-12,12-dimethyl-3-aza-11-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2(11),3,5,7,9,13,15,17(21),18-decaen-20-ol |
|---|---|
| PubChem CID | 162494110 |
| Molecular Formula | C40H34N3O2+ |
| Molecular Weight | 588.73 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | 4-(3-tert-butyl-5-isoquinolin-1-ylphenoxy)-12,12-dimethyl-3-aza-11-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2(11),3,5,7,9,13,15,17(21),18-decaen-20-ol |
| SMILES | CC(C)(C)c1cc(Oc2nc3[n+](c4ccccc24)C(C)(C)c2cccc4ccc(O)c-3c24)cc(-c2nccc3ccccc23)c1 |
| InChI | InChI=1S/C40H33N3O2/c1-39(2,3)27-21-26(36-29-13-7-6-11-24(29)19-20-41-36)22-28(23-27)45-38-30-14-8-9-16-32(30)43-37(42-38)35-33(44)18-17-25-12-10-15-31(34(25)35)40(43,4)5/h6-23H,1-5H3/p+1 |
| InChIKey | OZGDPVPDBZGLSL-UHFFFAOYSA-O |
| XLogP | 9.45 |
| TPSA | 59.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.73 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|