C36H33N — CID 58835648
9,16-ditert-butyl-4-naphthalen-1-yl-3-azapentacyclo[9.6.2.02,6.07,19.014,18]nonadeca-1,4,6,8,10,12,14,16,18-nonaene (PubChem CID 58835648) has the molecular formula C36H33N and a molecular weight of 479.67 g/mol. Its IUPAC name is 9,16-ditert-butyl-4-naphthalen-1-yl-3-azapentacyclo[9.6.2.02,6.07,19.014,18]nonadeca-1,4,6,8,10,12,14,16,18-nonaene.
| Compound Name | 9,16-ditert-butyl-4-naphthalen-1-yl-3-azapentacyclo[9.6.2.02,6.07,19.014,18]nonadeca-1,4,6,8,10,12,14,16,18-nonaene |
|---|---|
| PubChem CID | 58835648 |
| Molecular Formula | C36H33N |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 9,16-ditert-butyl-4-naphthalen-1-yl-3-azapentacyclo[9.6.2.02,6.07,19.014,18]nonadeca-1,4,6,8,10,12,14,16,18-nonaene |
| SMILES | CC(C)(C)c1cc2ccc3cc(C(C)(C)C)cc4c5[nH]c(-c6cccc7ccccc67)cc5c(c1)c2c34 |
| InChI | InChI=1S/C36H33N/c1-35(2,3)24-16-22-14-15-23-17-25(36(4,5)6)19-30-33(23)32(22)28(18-24)29-20-31(37-34(29)30)27-13-9-11-21-10-7-8-12-26(21)27/h7-20,37H,1-6H3 |
| InChIKey | MBBCLMAPNYGWNN-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|