C31H47N — CID 155180694
2,7-ditert-butyl-9-(2,3,5,6-tetramethylheptan-4-yl)carbazole (PubChem CID 155180694) has the molecular formula C31H47N and a molecular weight of 433.72 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-(2,3,5,6-tetramethylheptan-4-yl)carbazole.
| Compound Name | 2,7-ditert-butyl-9-(2,3,5,6-tetramethylheptan-4-yl)carbazole |
|---|---|
| PubChem CID | 155180694 |
| Molecular Formula | C31H47N |
| Molecular Weight | 433.72 g/mol |
| Exact Mass | 433.37 |
| IUPAC Name | 2,7-ditert-butyl-9-(2,3,5,6-tetramethylheptan-4-yl)carbazole |
| SMILES | CC(C)C(C)C(C(C)C(C)C)n1c2cc(C(C)(C)C)ccc2c2ccc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C31H47N/c1-19(2)21(5)29(22(6)20(3)4)32-27-17-23(30(7,8)9)13-15-25(27)26-16-14-24(18-28(26)32)31(10,11)12/h13-22,29H,1-12H3 |
| InChIKey | SORURBMFPOBUAA-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.72 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |