C17H23F2N — CID 139475103
2,6-ditert-butyl-1-(difluoromethyl)indole (PubChem CID 139475103) has the molecular formula C17H23F2N and a molecular weight of 279.37 g/mol. Its IUPAC name is 2,6-ditert-butyl-1-(difluoromethyl)indole.
| Compound Name | 2,6-ditert-butyl-1-(difluoromethyl)indole |
|---|---|
| PubChem CID | 139475103 |
| Molecular Formula | C17H23F2N |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 2,6-ditert-butyl-1-(difluoromethyl)indole |
| SMILES | CC(C)(C)c1ccc2cc(C(C)(C)C)n(C(F)F)c2c1 |
| InChI | InChI=1S/C17H23F2N/c1-16(2,3)12-8-7-11-9-14(17(4,5)6)20(15(18)19)13(11)10-12/h7-10,15H,1-6H3 |
| InChIKey | WSYOBXBVLTWLFC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |