C18H25N — CID 153429567
2,6-ditert-butyl-1-ethenylindole (PubChem CID 153429567) has the molecular formula C18H25N and a molecular weight of 255.40 g/mol. Its IUPAC name is 2,6-ditert-butyl-1-ethenylindole.
| Compound Name | 2,6-ditert-butyl-1-ethenylindole |
|---|---|
| PubChem CID | 153429567 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 2,6-ditert-butyl-1-ethenylindole |
| SMILES | C=Cn1c(C(C)(C)C)cc2ccc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C18H25N/c1-8-19-15-12-14(17(2,3)4)10-9-13(15)11-16(19)18(5,6)7/h8-12H,1H2,2-7H3 |
| InChIKey | DFLQHGJSZKFOFV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |