C18H18ClN — CID 91362505
1-(4-tert-butylphenyl)-2-chloroindole (PubChem CID 91362505) has the molecular formula C18H18ClN and a molecular weight of 283.80 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2-chloroindole.
| Compound Name | 1-(4-tert-butylphenyl)-2-chloroindole |
|---|---|
| PubChem CID | 91362505 |
| Molecular Formula | C18H18ClN |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2-chloroindole |
| SMILES | CC(C)(C)c1ccc(-n2c(Cl)cc3ccccc32)cc1 |
| InChI | InChI=1S/C18H18ClN/c1-18(2,3)14-8-10-15(11-9-14)20-16-7-5-4-6-13(16)12-17(20)19/h4-12H,1-3H3 |
| InChIKey | FEEJJXKTQJVIOK-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |