C31H34N2 — CID 59171906
2-tert-butyl-1-[4-(2-tert-butylindol-1-yl)-2-methylphenyl]indole (PubChem CID 59171906) has the molecular formula C31H34N2 and a molecular weight of 434.63 g/mol. Its IUPAC name is 2-tert-butyl-1-[4-(2-tert-butylindol-1-yl)-2-methylphenyl]indole.
| Compound Name | 2-tert-butyl-1-[4-(2-tert-butylindol-1-yl)-2-methylphenyl]indole |
|---|---|
| PubChem CID | 59171906 |
| Molecular Formula | C31H34N2 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 2-tert-butyl-1-[4-(2-tert-butylindol-1-yl)-2-methylphenyl]indole |
| SMILES | Cc1cc(-n2c(C(C)(C)C)cc3ccccc32)ccc1-n1c(C(C)(C)C)cc2ccccc21 |
| InChI | InChI=1S/C31H34N2/c1-21-18-24(32-26-14-10-8-12-22(26)19-28(32)30(2,3)4)16-17-25(21)33-27-15-11-9-13-23(27)20-29(33)31(5,6)7/h8-20H,1-7H3 |
| InChIKey | SNVBVVMPGINMOX-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |