C50H42Br4N2 — CID 132546601
1,4-bis(4-tert-butylphenyl)-2,5-bis[2-(3,5-dibromophenyl)phenyl]pyrrolo[3,2-b]pyrrole (PubChem CID 132546601) has the molecular formula C50H42Br4N2 and a molecular weight of 990.52 g/mol. Its IUPAC name is 1,4-bis(4-tert-butylphenyl)-2,5-bis[2-(3,5-dibromophenyl)phenyl]pyrrolo[3,2-b]pyrrole.
| Compound Name | 1,4-bis(4-tert-butylphenyl)-2,5-bis[2-(3,5-dibromophenyl)phenyl]pyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 132546601 |
| Molecular Formula | C50H42Br4N2 |
| Molecular Weight | 990.52 g/mol |
| Exact Mass | 986.01 |
| IUPAC Name | 1,4-bis(4-tert-butylphenyl)-2,5-bis[2-(3,5-dibromophenyl)phenyl]pyrrolo[3,2-b]pyrrole |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3ccccc3-c3cc(Br)cc(Br)c3)cc3c2cc(-c2ccccc2-c2cc(Br)cc(Br)c2)n3-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C50H42Br4N2/c1-49(2,3)33-15-19-39(20-16-33)55-45(43-13-9-7-11-41(43)31-23-35(51)27-36(52)24-31)29-48-47(55)30-46(56(48)40-21-17-34(18-22-40)50(4,5)6)44-14-10-8-12-42(44)32-25-37(53)28-38(54)26-32/h7-30H,1-6H3 |
| InChIKey | HLOWDHPGONWYPX-UHFFFAOYSA-N |
| XLogP | 16.73 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.52 |
| LogP ≤ 5 | 16.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |