C46H40Br2N2S2 — CID 132505063
2,5-bis(2-bromo-6-thiophen-2-ylphenyl)-1,4-bis(4-tert-butylphenyl)pyrrolo[3,2-b]pyrrole (PubChem CID 132505063) has the molecular formula C46H40Br2N2S2 and a molecular weight of 844.78 g/mol. Its IUPAC name is 2,5-bis(2-bromo-6-thiophen-2-ylphenyl)-1,4-bis(4-tert-butylphenyl)pyrrolo[3,2-b]pyrrole.
| Compound Name | 2,5-bis(2-bromo-6-thiophen-2-ylphenyl)-1,4-bis(4-tert-butylphenyl)pyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 132505063 |
| Molecular Formula | C46H40Br2N2S2 |
| Molecular Weight | 844.78 g/mol |
| Exact Mass | 842.10 |
| IUPAC Name | 2,5-bis(2-bromo-6-thiophen-2-ylphenyl)-1,4-bis(4-tert-butylphenyl)pyrrolo[3,2-b]pyrrole |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3c(Br)cccc3-c3cccs3)cc3c2cc(-c2c(Br)cccc2-c2cccs2)n3-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C46H40Br2N2S2/c1-45(2,3)29-17-21-31(22-18-29)49-37-27-40(44-34(12-8-14-36(44)48)42-16-10-26-52-42)50(32-23-19-30(20-24-32)46(4,5)6)38(37)28-39(49)43-33(11-7-13-35(43)47)41-15-9-25-51-41/h7-28H,1-6H3 |
| InChIKey | LMDDZVIKEWNLMG-UHFFFAOYSA-N |
| XLogP | 15.33 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.78 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |