C20H29N — CID 153429566
2,6-ditert-butyl-1-cyclobutylindole (PubChem CID 153429566) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is 2,6-ditert-butyl-1-cyclobutylindole.
| Compound Name | 2,6-ditert-butyl-1-cyclobutylindole |
|---|---|
| PubChem CID | 153429566 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 2,6-ditert-butyl-1-cyclobutylindole |
| SMILES | CC(C)(C)c1ccc2cc(C(C)(C)C)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C20H29N/c1-19(2,3)15-11-10-14-12-18(20(4,5)6)21(17(14)13-15)16-8-7-9-16/h10-13,16H,7-9H2,1-6H3 |
| InChIKey | GJGRMNMTTHDFIG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |