C26H26Br2ClN — CID 166581837
3,6-ditert-butyl-9-(3,5-dibromo-4-chlorophenyl)carbazole (PubChem CID 166581837) has the molecular formula C26H26Br2ClN and a molecular weight of 547.76 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-(3,5-dibromo-4-chlorophenyl)carbazole.
| Compound Name | 3,6-ditert-butyl-9-(3,5-dibromo-4-chlorophenyl)carbazole |
|---|---|
| PubChem CID | 166581837 |
| Molecular Formula | C26H26Br2ClN |
| Molecular Weight | 547.76 g/mol |
| Exact Mass | 545.01 |
| IUPAC Name | 3,6-ditert-butyl-9-(3,5-dibromo-4-chlorophenyl)carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(Br)c(Cl)c(Br)c1 |
| InChI | InChI=1S/C26H26Br2ClN/c1-25(2,3)15-7-9-22-18(11-15)19-12-16(26(4,5)6)8-10-23(19)30(22)17-13-20(27)24(29)21(28)14-17/h7-14H,1-6H3 |
| InChIKey | XYRDPZFPBKUGNW-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.76 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|