C74H77N5 — CID 140878395
3-isocyano-5-[3,4,5-tris(3,6-ditert-butylcarbazol-9-yl)phenyl]benzonitrile (PubChem CID 140878395) has the molecular formula C74H77N5 and a molecular weight of 1036.46 g/mol. Its IUPAC name is 3-isocyano-5-[3,4,5-tris(3,6-ditert-butylcarbazol-9-yl)phenyl]benzonitrile.
| Compound Name | 3-isocyano-5-[3,4,5-tris(3,6-ditert-butylcarbazol-9-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 140878395 |
| Molecular Formula | C74H77N5 |
| Molecular Weight | 1036.46 g/mol |
| Exact Mass | 1035.62 |
| IUPAC Name | 3-isocyano-5-[3,4,5-tris(3,6-ditert-butylcarbazol-9-yl)phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2cc(-n3c4ccc(C(C)(C)C)cc4c4cc(C(C)(C)C)ccc43)c(-n3c4ccc(C(C)(C)C)cc4c4cc(C(C)(C)C)ccc43)c(-n3c4ccc(C(C)(C)C)cc4c4cc(C(C)(C)C)ccc43)c2)c1 |
| InChI | InChI=1S/C74H77N5/c1-69(2,3)47-20-26-60-54(37-47)55-38-48(70(4,5)6)21-27-61(55)77(60)66-35-46(45-32-44(43-75)33-53(34-45)76-19)36-67(78-62-28-22-49(71(7,8)9)39-56(62)57-40-50(72(10,11)12)23-29-63(57)78)68(66)79-64-30-24-51(73(13,14)15)41-58(64)59-42-52(74(16,17)18)25-31-65(59)79/h20-42H,1-18H3 |
| InChIKey | DQYRZOAJCDDPIZ-UHFFFAOYSA-N |
| XLogP | 20.85 |
| TPSA | 42.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.46 |
| LogP ≤ 5 | 20.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|