C38H25N5 — CID 169284741
3-[9-(2-tert-butylphenyl)-6-(3-cyano-5-isocyanophenyl)carbazol-3-yl]-5-isocyanobenzonitrile (PubChem CID 169284741) has the molecular formula C38H25N5 and a molecular weight of 551.65 g/mol. Its IUPAC name is 3-[9-(2-tert-butylphenyl)-6-(3-cyano-5-isocyanophenyl)carbazol-3-yl]-5-isocyanobenzonitrile.
| Compound Name | 3-[9-(2-tert-butylphenyl)-6-(3-cyano-5-isocyanophenyl)carbazol-3-yl]-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 169284741 |
| Molecular Formula | C38H25N5 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 3-[9-(2-tert-butylphenyl)-6-(3-cyano-5-isocyanophenyl)carbazol-3-yl]-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2ccc3c(c2)c2cc(-c4cc(C#N)cc([N+]#[C-])c4)ccc2n3-c2ccccc2C(C)(C)C)c1 |
| InChI | InChI=1S/C38H25N5/c1-38(2,3)34-8-6-7-9-37(34)43-35-12-10-26(28-14-24(22-39)16-30(18-28)41-4)20-32(35)33-21-27(11-13-36(33)43)29-15-25(23-40)17-31(19-29)42-5/h6-21H,1-3H3 |
| InChIKey | ZAYVNDXZXBCUIQ-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 61.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|