C55H28F3N7 — CID 158182761
2,6-bis[2-(3-cyano-5-isocyanophenyl)carbazol-9-yl]-4-[2-methyl-6-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 158182761) has the molecular formula C55H28F3N7 and a molecular weight of 843.87 g/mol. Its IUPAC name is 2,6-bis[2-(3-cyano-5-isocyanophenyl)carbazol-9-yl]-4-[2-methyl-6-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 2,6-bis[2-(3-cyano-5-isocyanophenyl)carbazol-9-yl]-4-[2-methyl-6-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 158182761 |
| Molecular Formula | C55H28F3N7 |
| Molecular Weight | 843.87 g/mol |
| Exact Mass | 843.24 |
| IUPAC Name | 2,6-bis[2-(3-cyano-5-isocyanophenyl)carbazol-9-yl]-4-[2-methyl-6-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2ccc3c4ccccc4n(-c4cc(-c5c(C)cccc5C(F)(F)F)cc(-n5c6ccccc6c6ccc(-c7cc(C#N)cc([N+]#[C-])c7)cc65)c4C#N)c3c2)c1 |
| InChI | InChI=1S/C55H28F3N7/c1-32-9-8-12-47(55(56,57)58)54(32)39-27-52(64-48-13-6-4-10-42(48)44-17-15-35(25-50(44)64)37-19-33(29-59)21-40(23-37)62-2)46(31-61)53(28-39)65-49-14-7-5-11-43(49)45-18-16-36(26-51(45)65)38-20-34(30-60)22-41(24-38)63-3/h4-28H,1H3 |
| InChIKey | QIYRBKMSTQWBJH-UHFFFAOYSA-N |
| XLogP | 14.93 |
| TPSA | 89.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.87 |
| LogP ≤ 5 | 14.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|