C61H38F3N5 — CID 162110068
4-[2-methyl-6-(trifluoromethyl)phenyl]-2,6-bis[2-(6-phenyl-3-pyridinyl)carbazol-9-yl]benzonitrile (PubChem CID 162110068) has the molecular formula C61H38F3N5 and a molecular weight of 898.00 g/mol. Its IUPAC name is 4-[2-methyl-6-(trifluoromethyl)phenyl]-2,6-bis[2-(6-phenyl-3-pyridinyl)carbazol-9-yl]benzonitrile.
| Compound Name | 4-[2-methyl-6-(trifluoromethyl)phenyl]-2,6-bis[2-(6-phenyl-3-pyridinyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 162110068 |
| Molecular Formula | C61H38F3N5 |
| Molecular Weight | 898.00 g/mol |
| Exact Mass | 897.31 |
| IUPAC Name | 4-[2-methyl-6-(trifluoromethyl)phenyl]-2,6-bis[2-(6-phenyl-3-pyridinyl)carbazol-9-yl]benzonitrile |
| SMILES | Cc1cccc(C(F)(F)F)c1-c1cc(-n2c3ccccc3c3ccc(-c4ccc(-c5ccccc5)nc4)cc32)c(C#N)c(-n2c3ccccc3c3ccc(-c4ccc(-c5ccccc5)nc4)cc32)c1 |
| InChI | InChI=1S/C61H38F3N5/c1-38-13-12-20-51(61(62,63)64)60(38)45-33-58(68-54-21-10-8-18-46(54)48-27-23-41(31-56(48)68)43-25-29-52(66-36-43)39-14-4-2-5-15-39)50(35-65)59(34-45)69-55-22-11-9-19-47(55)49-28-24-42(32-57(49)69)44-26-30-53(67-37-44)40-16-6-3-7-17-40/h2-34,36-37H,1H3 |
| InChIKey | LDMKSSAWCGHTAS-UHFFFAOYSA-N |
| XLogP | 16.20 |
| TPSA | 59.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 898.00 |
| LogP ≤ 5 | 16.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |