C53H33F3N4 — CID 137382215
4-[2-cyano-6-(trifluoromethyl)phenyl]-2,6-bis[2-(3-methylphenyl)carbazol-9-yl]benzonitrile (PubChem CID 137382215) has the molecular formula C53H33F3N4 and a molecular weight of 782.87 g/mol. Its IUPAC name is 4-[2-cyano-6-(trifluoromethyl)phenyl]-2,6-bis[2-(3-methylphenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 4-[2-cyano-6-(trifluoromethyl)phenyl]-2,6-bis[2-(3-methylphenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 137382215 |
| Molecular Formula | C53H33F3N4 |
| Molecular Weight | 782.87 g/mol |
| Exact Mass | 782.27 |
| IUPAC Name | 4-[2-cyano-6-(trifluoromethyl)phenyl]-2,6-bis[2-(3-methylphenyl)carbazol-9-yl]benzonitrile |
| SMILES | Cc1cccc(-c2ccc3c4ccccc4n(-c4cc(-c5c(C#N)cccc5C(F)(F)F)cc(-n5c6ccccc6c6ccc(-c7cccc(C)c7)cc65)c4C#N)c3c2)c1 |
| InChI | InChI=1S/C53H33F3N4/c1-32-10-7-12-34(24-32)36-20-22-42-40-15-3-5-18-46(40)59(48(42)26-36)50-28-39(52-38(30-57)14-9-17-45(52)53(54,55)56)29-51(44(50)31-58)60-47-19-6-4-16-41(47)43-23-21-37(27-49(43)60)35-13-8-11-33(2)25-35/h3-29H,1-2H3 |
| InChIKey | XLCALXJXAHVCQX-UHFFFAOYSA-N |
| XLogP | 14.26 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.87 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |