C83H49F6N7 — CID 146520059
2,6-bis[3,6-bis(6-phenyl-3-pyridinyl)carbazol-9-yl]-3-[2,6-bis(trifluoromethyl)phenyl]benzonitrile (PubChem CID 146520059) has the molecular formula C83H49F6N7 and a molecular weight of 1258.34 g/mol. Its IUPAC name is 2,6-bis[3,6-bis(6-phenyl-3-pyridinyl)carbazol-9-yl]-3-[2,6-bis(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 2,6-bis[3,6-bis(6-phenyl-3-pyridinyl)carbazol-9-yl]-3-[2,6-bis(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 146520059 |
| Molecular Formula | C83H49F6N7 |
| Molecular Weight | 1258.34 g/mol |
| Exact Mass | 1257.40 |
| IUPAC Name | 2,6-bis[3,6-bis(6-phenyl-3-pyridinyl)carbazol-9-yl]-3-[2,6-bis(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1c(-n2c3ccc(-c4ccc(-c5ccccc5)nc4)cc3c3cc(-c4ccc(-c5ccccc5)nc4)ccc32)ccc(-c2c(C(F)(F)F)cccc2C(F)(F)F)c1-n1c2ccc(-c3ccc(-c4ccccc4)nc3)cc2c2cc(-c3ccc(-c4ccccc4)nc3)ccc21 |
| InChI | InChI=1S/C83H49F6N7/c84-82(85,86)69-22-13-23-70(83(87,88)89)80(69)63-32-41-79(95-75-37-28-55(59-24-33-71(91-47-59)51-14-5-1-6-15-51)42-64(75)65-43-56(29-38-76(65)95)60-25-34-72(92-48-60)52-16-7-2-8-17-52)68(46-90)81(63)96-77-39-30-57(61-26-35-73(93-49-61)53-18-9-3-10-19-53)44-66(77)67-45-58(31-40-78(67)96)62-27-36-74(94-50-62)54-20-11-4-12-21-54/h1-45,47-50H |
| InChIKey | ZKUNSPDEPUTBBZ-UHFFFAOYSA-N |
| XLogP | 22.37 |
| TPSA | 85.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 96 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1258.34 |
| LogP ≤ 5 | 22.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |