C47H25F6N7 — CID 137392931
3-[2,6-bis(trifluoromethyl)phenyl]-2,6-bis(2-pyrimidin-2-ylcarbazol-9-yl)benzonitrile (PubChem CID 137392931) has the molecular formula C47H25F6N7 and a molecular weight of 801.75 g/mol. Its IUPAC name is 3-[2,6-bis(trifluoromethyl)phenyl]-2,6-bis(2-pyrimidin-2-ylcarbazol-9-yl)benzonitrile.
| Compound Name | 3-[2,6-bis(trifluoromethyl)phenyl]-2,6-bis(2-pyrimidin-2-ylcarbazol-9-yl)benzonitrile |
|---|---|
| PubChem CID | 137392931 |
| Molecular Formula | C47H25F6N7 |
| Molecular Weight | 801.75 g/mol |
| Exact Mass | 801.21 |
| IUPAC Name | 3-[2,6-bis(trifluoromethyl)phenyl]-2,6-bis(2-pyrimidin-2-ylcarbazol-9-yl)benzonitrile |
| SMILES | N#Cc1c(-n2c3ccccc3c3ccc(-c4ncccn4)cc32)ccc(-c2c(C(F)(F)F)cccc2C(F)(F)F)c1-n1c2ccccc2c2ccc(-c3ncccn3)cc21 |
| InChI | InChI=1S/C47H25F6N7/c48-46(49,50)35-10-5-11-36(47(51,52)53)42(35)33-18-19-39(59-37-12-3-1-8-29(37)31-16-14-27(24-40(31)59)44-55-20-6-21-56-44)34(26-54)43(33)60-38-13-4-2-9-30(38)32-17-15-28(25-41(32)60)45-57-22-7-23-58-45/h1-25H |
| InChIKey | XCFNFENFWKGCOA-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 85.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.75 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |