C69H39F6N9 — CID 146520993
3-[2,6-bis(trifluoromethyl)phenyl]-2,6-bis[2-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]benzonitrile (PubChem CID 146520993) has the molecular formula C69H39F6N9 and a molecular weight of 1108.12 g/mol. Its IUPAC name is 3-[2,6-bis(trifluoromethyl)phenyl]-2,6-bis[2-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]benzonitrile.
| Compound Name | 3-[2,6-bis(trifluoromethyl)phenyl]-2,6-bis[2-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 146520993 |
| Molecular Formula | C69H39F6N9 |
| Molecular Weight | 1108.12 g/mol |
| Exact Mass | 1107.32 |
| IUPAC Name | 3-[2,6-bis(trifluoromethyl)phenyl]-2,6-bis[2-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]benzonitrile |
| SMILES | N#Cc1c(-n2c3ccccc3c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc32)ccc(-c2c(C(F)(F)F)cccc2C(F)(F)F)c1-n1c2ccccc2c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C69H39F6N9/c70-68(71,72)53-28-17-29-54(69(73,74)75)60(53)51-36-37-57(83-55-30-15-13-26-47(55)49-34-32-45(38-58(49)83)66-79-62(41-18-5-1-6-19-41)77-63(80-66)42-20-7-2-8-21-42)52(40-76)61(51)84-56-31-16-14-27-48(56)50-35-33-46(39-59(50)84)67-81-64(43-22-9-3-10-23-43)78-65(82-67)44-24-11-4-12-25-44/h1-39H |
| InChIKey | HKKJWDMGKLACFQ-UHFFFAOYSA-N |
| XLogP | 17.83 |
| TPSA | 110.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1108.12 |
| LogP ≤ 5 | 17.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |