C55H25F18N3 — CID 146519991
3-[2,6-bis(trifluoromethyl)phenyl]-2,6-bis[3-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]benzonitrile (PubChem CID 146519991) has the molecular formula C55H25F18N3 and a molecular weight of 1069.79 g/mol. Its IUPAC name is 3-[2,6-bis(trifluoromethyl)phenyl]-2,6-bis[3-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]benzonitrile.
| Compound Name | 3-[2,6-bis(trifluoromethyl)phenyl]-2,6-bis[3-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 146519991 |
| Molecular Formula | C55H25F18N3 |
| Molecular Weight | 1069.79 g/mol |
| Exact Mass | 1069.18 |
| IUPAC Name | 3-[2,6-bis(trifluoromethyl)phenyl]-2,6-bis[3-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]benzonitrile |
| SMILES | N#Cc1c(-n2c3ccccc3c3cc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)ccc32)ccc(-c2c(C(F)(F)F)cccc2C(F)(F)F)c1-n1c2ccccc2c2cc(-c3ccc(C(F)(F)F)cc3C(F)(F)F)ccc21 |
| InChI | InChI=1S/C55H25F18N3/c56-50(57,58)29-14-16-31(41(24-29)54(68,69)70)27-12-19-45-36(22-27)33-6-1-3-10-43(33)75(45)47-21-18-35(48-39(52(62,63)64)8-5-9-40(48)53(65,66)67)49(38(47)26-74)76-44-11-4-2-7-34(44)37-23-28(13-20-46(37)76)32-17-15-30(51(59,60)61)25-42(32)55(71,72)73/h1-25H |
| InChIKey | PHNTVVZITKMUPM-UHFFFAOYSA-N |
| XLogP | 18.87 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1069.79 |
| LogP ≤ 5 | 18.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |