C40H19F2N5 — CID 169284731
3-[6-(3-cyano-5-isocyanophenyl)-9-[2-(2,3-difluorophenyl)phenyl]carbazol-3-yl]-5-isocyanobenzonitrile (PubChem CID 169284731) has the molecular formula C40H19F2N5 and a molecular weight of 607.62 g/mol. Its IUPAC name is 3-[6-(3-cyano-5-isocyanophenyl)-9-[2-(2,3-difluorophenyl)phenyl]carbazol-3-yl]-5-isocyanobenzonitrile.
| Compound Name | 3-[6-(3-cyano-5-isocyanophenyl)-9-[2-(2,3-difluorophenyl)phenyl]carbazol-3-yl]-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 169284731 |
| Molecular Formula | C40H19F2N5 |
| Molecular Weight | 607.62 g/mol |
| Exact Mass | 607.16 |
| IUPAC Name | 3-[6-(3-cyano-5-isocyanophenyl)-9-[2-(2,3-difluorophenyl)phenyl]carbazol-3-yl]-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2ccc3c(c2)c2cc(-c4cc(C#N)cc([N+]#[C-])c4)ccc2n3-c2ccccc2-c2cccc(F)c2F)c1 |
| InChI | InChI=1S/C40H19F2N5/c1-45-30-16-24(22-43)14-28(18-30)26-10-12-38-34(20-26)35-21-27(29-15-25(23-44)17-31(19-29)46-2)11-13-39(35)47(38)37-9-4-3-6-32(37)33-7-5-8-36(41)40(33)42/h3-21H |
| InChIKey | ZFIUSPRPAMNCPR-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 61.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.62 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|