C34H23N3 — CID 140705080
2-(3,6-diphenylcarbazol-9-yl)-3-isocyano-4,5-dimethylbenzonitrile (PubChem CID 140705080) has the molecular formula C34H23N3 and a molecular weight of 473.58 g/mol. Its IUPAC name is 2-(3,6-diphenylcarbazol-9-yl)-3-isocyano-4,5-dimethylbenzonitrile.
| Compound Name | 2-(3,6-diphenylcarbazol-9-yl)-3-isocyano-4,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 140705080 |
| Molecular Formula | C34H23N3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 2-(3,6-diphenylcarbazol-9-yl)-3-isocyano-4,5-dimethylbenzonitrile |
| SMILES | [C-]#[N+]c1c(C)c(C)cc(C#N)c1-n1c2ccc(-c3ccccc3)cc2c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C34H23N3/c1-22-18-28(21-35)34(33(36-3)23(22)2)37-31-16-14-26(24-10-6-4-7-11-24)19-29(31)30-20-27(15-17-32(30)37)25-12-8-5-9-13-25/h4-20H,1-2H3 |
| InChIKey | RSIRDQDDGIRJMS-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 33.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|