C69H63N5O — CID 155131622
3,4-bis(3,6-ditert-butylcarbazol-9-yl)-6-(4,6-diphenylpyrimidin-2-yl)dibenzofuran-2-carbonitrile (PubChem CID 155131622) has the molecular formula C69H63N5O and a molecular weight of 978.30 g/mol. Its IUPAC name is 3,4-bis(3,6-ditert-butylcarbazol-9-yl)-6-(4,6-diphenylpyrimidin-2-yl)dibenzofuran-2-carbonitrile.
| Compound Name | 3,4-bis(3,6-ditert-butylcarbazol-9-yl)-6-(4,6-diphenylpyrimidin-2-yl)dibenzofuran-2-carbonitrile |
|---|---|
| PubChem CID | 155131622 |
| Molecular Formula | C69H63N5O |
| Molecular Weight | 978.30 g/mol |
| Exact Mass | 977.50 |
| IUPAC Name | 3,4-bis(3,6-ditert-butylcarbazol-9-yl)-6-(4,6-diphenylpyrimidin-2-yl)dibenzofuran-2-carbonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1c(C#N)cc2c(oc3c(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)cccc32)c1-n1c2ccc(C(C)(C)C)cc2c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C69H63N5O/c1-66(2,3)44-26-30-57-50(35-44)51-36-45(67(4,5)6)27-31-58(51)73(57)61-43(40-70)34-54-48-24-19-25-49(65-71-55(41-20-15-13-16-21-41)39-56(72-65)42-22-17-14-18-23-42)63(48)75-64(54)62(61)74-59-32-28-46(68(7,8)9)37-52(59)53-38-47(69(10,11)12)29-33-60(53)74/h13-39H,1-12H3 |
| InChIKey | VCUTTYWRECMSCL-UHFFFAOYSA-N |
| XLogP | 18.63 |
| TPSA | 72.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.30 |
| LogP ≤ 5 | 18.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |