C68H62N6O — CID 155139853
3,4-bis(3,6-ditert-butylcarbazol-9-yl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-carbonitrile (PubChem CID 155139853) has the molecular formula C68H62N6O and a molecular weight of 979.28 g/mol. Its IUPAC name is 3,4-bis(3,6-ditert-butylcarbazol-9-yl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-carbonitrile.
| Compound Name | 3,4-bis(3,6-ditert-butylcarbazol-9-yl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-carbonitrile |
|---|---|
| PubChem CID | 155139853 |
| Molecular Formula | C68H62N6O |
| Molecular Weight | 979.28 g/mol |
| Exact Mass | 978.50 |
| IUPAC Name | 3,4-bis(3,6-ditert-butylcarbazol-9-yl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-carbonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(C#N)c2c(oc3c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cccc32)c1-n1c2ccc(C(C)(C)C)cc2c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C68H62N6O/c1-65(2,3)43-26-30-53-49(35-43)50-36-44(66(4,5)6)27-31-54(50)73(53)57-34-42(39-69)58-47-24-19-25-48(64-71-62(40-20-15-13-16-21-40)70-63(72-64)41-22-17-14-18-23-41)60(47)75-61(58)59(57)74-55-32-28-45(67(7,8)9)37-51(55)52-38-46(68(10,11)12)29-33-56(52)74/h13-38H,1-12H3 |
| InChIKey | MPYYXEHRZRBSJZ-UHFFFAOYSA-N |
| XLogP | 18.03 |
| TPSA | 85.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.28 |
| LogP ≤ 5 | 18.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |