C59H57N3O — CID 155617319
3,6-ditert-butyl-9-[1-(3,6-ditert-butylcarbazol-9-yl)-4-isocyano-6-phenyldibenzofuran-2-yl]carbazole (PubChem CID 155617319) has the molecular formula C59H57N3O and a molecular weight of 824.12 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[1-(3,6-ditert-butylcarbazol-9-yl)-4-isocyano-6-phenyldibenzofuran-2-yl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[1-(3,6-ditert-butylcarbazol-9-yl)-4-isocyano-6-phenyldibenzofuran-2-yl]carbazole |
|---|---|
| PubChem CID | 155617319 |
| Molecular Formula | C59H57N3O |
| Molecular Weight | 824.12 g/mol |
| Exact Mass | 823.45 |
| IUPAC Name | 3,6-ditert-butyl-9-[1-(3,6-ditert-butylcarbazol-9-yl)-4-isocyano-6-phenyldibenzofuran-2-yl]carbazole |
| SMILES | [C-]#[N+]c1cc(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)c(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)c2c1oc1c(-c3ccccc3)cccc12 |
| InChI | InChI=1S/C59H57N3O/c1-56(2,3)36-22-26-47-42(30-36)43-31-37(57(4,5)6)23-27-48(43)61(47)51-34-46(60-13)55-52(41-21-17-20-40(54(41)63-55)35-18-15-14-16-19-35)53(51)62-49-28-24-38(58(7,8)9)32-44(49)45-33-39(59(10,11)12)25-29-50(45)62/h14-34H,1-12H3 |
| InChIKey | FTHHXHOBWARSBR-UHFFFAOYSA-N |
| XLogP | 17.19 |
| TPSA | 27.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.12 |
| LogP ≤ 5 | 17.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|