C67H41N3O — CID 155617223
9-[3-(3,6-diphenylcarbazol-9-yl)-2-isocyano-6-phenyldibenzofuran-4-yl]-3,6-diphenylcarbazole (PubChem CID 155617223) has the molecular formula C67H41N3O and a molecular weight of 904.09 g/mol. Its IUPAC name is 9-[3-(3,6-diphenylcarbazol-9-yl)-2-isocyano-6-phenyldibenzofuran-4-yl]-3,6-diphenylcarbazole.
| Compound Name | 9-[3-(3,6-diphenylcarbazol-9-yl)-2-isocyano-6-phenyldibenzofuran-4-yl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 155617223 |
| Molecular Formula | C67H41N3O |
| Molecular Weight | 904.09 g/mol |
| Exact Mass | 903.32 |
| IUPAC Name | 9-[3-(3,6-diphenylcarbazol-9-yl)-2-isocyano-6-phenyldibenzofuran-4-yl]-3,6-diphenylcarbazole |
| SMILES | [C-]#[N+]c1cc2c(oc3c(-c4ccccc4)cccc32)c(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)c1-n1c2ccc(-c3ccccc3)cc2c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C67H41N3O/c1-68-59-42-58-53-29-17-28-52(47-26-15-6-16-27-47)66(53)71-67(58)65(70-62-36-32-50(45-22-11-4-12-23-45)40-56(62)57-41-51(33-37-63(57)70)46-24-13-5-14-25-46)64(59)69-60-34-30-48(43-18-7-2-8-19-43)38-54(60)55-39-49(31-35-61(55)69)44-20-9-3-10-21-44/h2-42H |
| InChIKey | WDZHZQMSPRSLNZ-UHFFFAOYSA-N |
| XLogP | 18.67 |
| TPSA | 27.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.09 |
| LogP ≤ 5 | 18.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|