C77H47N5O — CID 155617359
9-[1-(3,6-diphenylcarbazol-9-yl)-6-(4,6-diphenylpyrimidin-2-yl)-4-isocyanodibenzofuran-2-yl]-3,6-diphenylcarbazole (PubChem CID 155617359) has the molecular formula C77H47N5O and a molecular weight of 1058.26 g/mol. Its IUPAC name is 9-[1-(3,6-diphenylcarbazol-9-yl)-6-(4,6-diphenylpyrimidin-2-yl)-4-isocyanodibenzofuran-2-yl]-3,6-diphenylcarbazole.
| Compound Name | 9-[1-(3,6-diphenylcarbazol-9-yl)-6-(4,6-diphenylpyrimidin-2-yl)-4-isocyanodibenzofuran-2-yl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 155617359 |
| Molecular Formula | C77H47N5O |
| Molecular Weight | 1058.26 g/mol |
| Exact Mass | 1057.38 |
| IUPAC Name | 9-[1-(3,6-diphenylcarbazol-9-yl)-6-(4,6-diphenylpyrimidin-2-yl)-4-isocyanodibenzofuran-2-yl]-3,6-diphenylcarbazole |
| SMILES | [C-]#[N+]c1cc(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)c(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)c2c1oc1c(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)cccc12 |
| InChI | InChI=1S/C77H47N5O/c1-78-67-48-72(81-68-39-35-55(49-21-8-2-9-22-49)43-61(68)62-44-56(36-40-69(62)81)50-23-10-3-11-24-50)74(82-70-41-37-57(51-25-12-4-13-26-51)45-63(70)64-46-58(38-42-71(64)82)52-27-14-5-15-28-52)73-59-33-20-34-60(75(59)83-76(67)73)77-79-65(53-29-16-6-17-30-53)47-66(80-77)54-31-18-7-19-32-54/h2-48H |
| InChIKey | VSDPSIIJJXIEPJ-UHFFFAOYSA-N |
| XLogP | 20.79 |
| TPSA | 53.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1058.26 |
| LogP ≤ 5 | 20.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|