C58H55N3 — CID 146280540
1,3,6-tritert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-diphenylphenyl]carbazole (PubChem CID 146280540) has the molecular formula C58H55N3 and a molecular weight of 794.10 g/mol. Its IUPAC name is 1,3,6-tritert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-diphenylphenyl]carbazole.
| Compound Name | 1,3,6-tritert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-diphenylphenyl]carbazole |
|---|---|
| PubChem CID | 146280540 |
| Molecular Formula | C58H55N3 |
| Molecular Weight | 794.10 g/mol |
| Exact Mass | 793.44 |
| IUPAC Name | 1,3,6-tritert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-diphenylphenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)cc(C(C)(C)C)c1n2-c1c(-c2ccccc2)cc(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc1-c1ccccc1 |
| InChI | InChI=1S/C58H55N3/c1-56(2,3)43-30-31-52-47(34-43)48-35-44(57(4,5)6)36-49(58(7,8)9)54(48)61(52)53-45(38-22-14-10-15-23-38)32-42(33-46(53)39-24-16-11-17-25-39)55-59-50(40-26-18-12-19-27-40)37-51(60-55)41-28-20-13-21-29-41/h10-37H,1-9H3 |
| InChIKey | STLIRIAGCAGXLG-UHFFFAOYSA-N |
| XLogP | 15.80 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.10 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |