C58H53N3S — CID 146280712
4-[3,5-diphenyl-4-(1,3,6-tritert-butylcarbazol-9-yl)phenyl]-2-phenyl-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 146280712) has the molecular formula C58H53N3S and a molecular weight of 824.15 g/mol. Its IUPAC name is 4-[3,5-diphenyl-4-(1,3,6-tritert-butylcarbazol-9-yl)phenyl]-2-phenyl-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 4-[3,5-diphenyl-4-(1,3,6-tritert-butylcarbazol-9-yl)phenyl]-2-phenyl-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 146280712 |
| Molecular Formula | C58H53N3S |
| Molecular Weight | 824.15 g/mol |
| Exact Mass | 823.40 |
| IUPAC Name | 4-[3,5-diphenyl-4-(1,3,6-tritert-butylcarbazol-9-yl)phenyl]-2-phenyl-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)cc(C(C)(C)C)c1n2-c1c(-c2ccccc2)cc(-c2nc(-c3ccccc3)nc3c2sc2ccccc23)cc1-c1ccccc1 |
| InChI | InChI=1S/C58H53N3S/c1-56(2,3)40-29-30-48-45(33-40)46-34-41(57(4,5)6)35-47(58(7,8)9)53(46)61(48)52-43(36-21-13-10-14-22-36)31-39(32-44(52)37-23-15-11-16-24-37)50-54-51(42-27-19-20-28-49(42)62-54)60-55(59-50)38-25-17-12-18-26-38/h10-35H,1-9H3 |
| InChIKey | KSMILTNCDXERPI-UHFFFAOYSA-N |
| XLogP | 16.50 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.15 |
| LogP ≤ 5 | 16.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |