C48H27N5S — CID 153301165
4-[4-(3,6-diisocyanocarbazol-9-yl)-3,5-diphenylphenyl]-2-phenyl-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 153301165) has the molecular formula C48H27N5S and a molecular weight of 705.85 g/mol. Its IUPAC name is 4-[4-(3,6-diisocyanocarbazol-9-yl)-3,5-diphenylphenyl]-2-phenyl-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 4-[4-(3,6-diisocyanocarbazol-9-yl)-3,5-diphenylphenyl]-2-phenyl-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 153301165 |
| Molecular Formula | C48H27N5S |
| Molecular Weight | 705.85 g/mol |
| Exact Mass | 705.20 |
| IUPAC Name | 4-[4-(3,6-diisocyanocarbazol-9-yl)-3,5-diphenylphenyl]-2-phenyl-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc([N+]#[C-])ccc1n2-c1c(-c2ccccc2)cc(-c2nc(-c3ccccc3)nc3c2sc2ccccc23)cc1-c1ccccc1 |
| InChI | InChI=1S/C48H27N5S/c1-49-34-22-24-41-39(28-34)40-29-35(50-2)23-25-42(40)53(41)46-37(30-14-6-3-7-15-30)26-33(27-38(46)31-16-8-4-9-17-31)44-47-45(36-20-12-13-21-43(36)54-47)52-48(51-44)32-18-10-5-11-19-32/h3-29H |
| InChIKey | ZQGZSDSBCVGLRH-UHFFFAOYSA-N |
| XLogP | 13.71 |
| TPSA | 39.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.85 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|