C58H33N5S2 — CID 153301136
9-[4-[4,6-di(dibenzothiophen-3-yl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-3-isocyanocarbazole (PubChem CID 153301136) has the molecular formula C58H33N5S2 and a molecular weight of 864.07 g/mol. Its IUPAC name is 9-[4-[4,6-di(dibenzothiophen-3-yl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-3-isocyanocarbazole.
| Compound Name | 9-[4-[4,6-di(dibenzothiophen-3-yl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-3-isocyanocarbazole |
|---|---|
| PubChem CID | 153301136 |
| Molecular Formula | C58H33N5S2 |
| Molecular Weight | 864.07 g/mol |
| Exact Mass | 863.22 |
| IUPAC Name | 9-[4-[4,6-di(dibenzothiophen-3-yl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-3-isocyanocarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1c(-c2ccccc2)cc(-c2nc(-c3ccc4c(c3)sc3ccccc34)nc(-c3ccc4c(c3)sc3ccccc34)n2)cc1-c1ccccc1 |
| InChI | InChI=1S/C58H33N5S2/c1-59-40-26-29-50-48(34-40)41-18-8-11-21-49(41)63(50)55-46(35-14-4-2-5-15-35)30-39(31-47(55)36-16-6-3-7-17-36)58-61-56(37-24-27-44-42-19-9-12-22-51(42)64-53(44)32-37)60-57(62-58)38-25-28-45-43-20-10-13-23-52(43)65-54(45)33-38/h2-34H |
| InChIKey | RKYLGGHUFDRFPC-UHFFFAOYSA-N |
| XLogP | 16.59 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.07 |
| LogP ≤ 5 | 16.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|