C73H54N4 — CID 146280895
1-tert-butyl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]-3,6-diphenylcarbazole (PubChem CID 146280895) has the molecular formula C73H54N4 and a molecular weight of 987.26 g/mol. Its IUPAC name is 1-tert-butyl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]-3,6-diphenylcarbazole.
| Compound Name | 1-tert-butyl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 146280895 |
| Molecular Formula | C73H54N4 |
| Molecular Weight | 987.26 g/mol |
| Exact Mass | 986.43 |
| IUPAC Name | 1-tert-butyl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]-3,6-diphenylcarbazole |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)cc2c3cc(-c4ccccc4)ccc3n(-c3c(-c4ccc(-c5ccccc5)cc4)cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3-c3ccc(-c4ccccc4)cc3)c12 |
| InChI | InChI=1S/C73H54N4/c1-73(2,3)66-48-60(52-28-16-7-17-29-52)45-65-64-44-59(51-26-14-6-15-27-51)42-43-67(64)77(69(65)66)68-62(55-38-34-53(35-39-55)49-22-10-4-11-23-49)46-61(47-63(68)56-40-36-54(37-41-56)50-24-12-5-13-25-50)72-75-70(57-30-18-8-19-31-57)74-71(76-72)58-32-20-9-21-33-58/h4-48H,1-3H3 |
| InChIKey | NDSOUMDVJDRQMY-UHFFFAOYSA-N |
| XLogP | 19.27 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.26 |
| LogP ≤ 5 | 19.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |