C49H31F6N3 — CID 155446598
9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-bis[4-(trifluoromethyl)phenyl]phenyl]-3-methylcarbazole (PubChem CID 155446598) has the molecular formula C49H31F6N3 and a molecular weight of 775.80 g/mol. Its IUPAC name is 9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-bis[4-(trifluoromethyl)phenyl]phenyl]-3-methylcarbazole.
| Compound Name | 9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-bis[4-(trifluoromethyl)phenyl]phenyl]-3-methylcarbazole |
|---|---|
| PubChem CID | 155446598 |
| Molecular Formula | C49H31F6N3 |
| Molecular Weight | 775.80 g/mol |
| Exact Mass | 775.24 |
| IUPAC Name | 9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-bis[4-(trifluoromethyl)phenyl]phenyl]-3-methylcarbazole |
| SMILES | Cc1ccc2c(c1)c1ccccc1n2-c1c(-c2ccc(C(F)(F)F)cc2)cc(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C49H31F6N3/c1-30-16-25-45-41(26-30)38-14-8-9-15-44(38)58(45)46-39(31-17-21-36(22-18-31)48(50,51)52)27-35(28-40(46)32-19-23-37(24-20-32)49(53,54)55)47-56-42(33-10-4-2-5-11-33)29-43(57-47)34-12-6-3-7-13-34/h2-29H,1H3 |
| InChIKey | HYQAOLHYNAUNGV-UHFFFAOYSA-N |
| XLogP | 14.25 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.80 |
| LogP ≤ 5 | 14.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |