C65H42N8 — CID 155447563
5-[2-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-3-(3,5-dicyanophenyl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzene-1,3-dicarbonitrile (PubChem CID 155447563) has the molecular formula C65H42N8 and a molecular weight of 935.11 g/mol. Its IUPAC name is 5-[2-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-3-(3,5-dicyanophenyl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[2-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-3-(3,5-dicyanophenyl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 155447563 |
| Molecular Formula | C65H42N8 |
| Molecular Weight | 935.11 g/mol |
| Exact Mass | 934.35 |
| IUPAC Name | 5-[2-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-3-(3,5-dicyanophenyl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzene-1,3-dicarbonitrile |
| SMILES | Cc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C)cc4C)ccc2n3-c2c(-c3cc(C#N)cc(C#N)c3)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2cc(C#N)cc(C#N)c2)c(C)c1 |
| InChI | InChI=1S/C65H42N8/c1-39-15-19-54(41(3)23-39)49-17-21-60-58(31-49)59-32-50(55-20-16-40(2)24-42(55)4)18-22-61(59)73(60)62-56(51-27-43(35-66)25-44(28-51)36-67)33-53(34-57(62)52-29-45(37-68)26-46(30-52)38-69)65-71-63(47-11-7-5-8-12-47)70-64(72-65)48-13-9-6-10-14-48/h5-34H,1-4H3 |
| InChIKey | JPWSLMRAWLVGSX-UHFFFAOYSA-N |
| XLogP | 15.36 |
| TPSA | 138.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.11 |
| LogP ≤ 5 | 15.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |