C68H43N11 — CID 138578744
3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-2-ylphenyl]carbazole (PubChem CID 138578744) has the molecular formula C68H43N11 and a molecular weight of 1014.17 g/mol. Its IUPAC name is 3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-2-ylphenyl]carbazole.
| Compound Name | 3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-2-ylphenyl]carbazole |
|---|---|
| PubChem CID | 138578744 |
| Molecular Formula | C68H43N11 |
| Molecular Weight | 1014.17 g/mol |
| Exact Mass | 1013.37 |
| IUPAC Name | 3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-2-ylphenyl]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)c3cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc3n4-c3ccc(-c4ccccn4)cc3-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)n2)cc1 |
| InChI | InChI=1S/C68H43N11/c1-7-21-44(22-8-1)60-70-61(45-23-9-2-10-24-45)74-66(73-60)51-35-38-57-53(42-51)54-43-52(67-75-62(46-25-11-3-12-26-46)71-63(76-67)47-27-13-4-14-28-47)36-39-58(54)79(57)59-37-34-50(56-33-19-20-40-69-56)41-55(59)68-77-64(48-29-15-5-16-30-48)72-65(78-68)49-31-17-6-18-32-49/h1-43H |
| InChIKey | HEXLTBFWEGJBAR-UHFFFAOYSA-N |
| XLogP | 15.40 |
| TPSA | 133.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.17 |
| LogP ≤ 5 | 15.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |