C53H34N8 — CID 138578743
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-2-ylphenyl]carbazole (PubChem CID 138578743) has the molecular formula C53H34N8 and a molecular weight of 782.91 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-2-ylphenyl]carbazole.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-2-ylphenyl]carbazole |
|---|---|
| PubChem CID | 138578743 |
| Molecular Formula | C53H34N8 |
| Molecular Weight | 782.91 g/mol |
| Exact Mass | 782.29 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-2-ylphenyl]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c5ccccc5n(-c5ccc(-c6ccccn6)cc5-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4c3)n2)cc1 |
| InChI | InChI=1S/C53H34N8/c1-5-17-35(18-6-1)48-55-49(36-19-7-2-8-20-36)58-52(57-48)40-28-30-42-41-25-13-14-27-45(41)61(47(42)34-40)46-31-29-39(44-26-15-16-32-54-44)33-43(46)53-59-50(37-21-9-3-10-22-37)56-51(60-53)38-23-11-4-12-24-38/h1-34H |
| InChIKey | CCSQXBFCFCEYAK-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.91 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |