C58H37N9 — CID 167168656
9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-dipyridin-2-ylcarbazole (PubChem CID 167168656) has the molecular formula C58H37N9 and a molecular weight of 860.00 g/mol. Its IUPAC name is 9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-dipyridin-2-ylcarbazole.
| Compound Name | 9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-dipyridin-2-ylcarbazole |
|---|---|
| PubChem CID | 167168656 |
| Molecular Formula | C58H37N9 |
| Molecular Weight | 860.00 g/mol |
| Exact Mass | 859.32 |
| IUPAC Name | 9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-dipyridin-2-ylcarbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3-n3c4ccc(-c5ccccn5)cc4c4cc(-c5ccccn5)ccc43)n2)cc1 |
| InChI | InChI=1S/C58H37N9/c1-5-18-38(19-6-1)53-61-54(39-20-7-2-8-21-39)64-57(63-53)44-26-17-27-45(58-65-55(40-22-9-3-10-23-40)62-56(66-58)41-24-11-4-12-25-41)52(44)67-50-32-30-42(48-28-13-15-34-59-48)36-46(50)47-37-43(31-33-51(47)67)49-29-14-16-35-60-49/h1-37H |
| InChIKey | ZEFSVJPTFJQUGW-UHFFFAOYSA-N |
| XLogP | 13.28 |
| TPSA | 108.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.00 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |