C54H41N5 — CID 138579172
2,7-bis(3,5-dimethylphenyl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-4-ylphenyl]carbazole (PubChem CID 138579172) has the molecular formula C54H41N5 and a molecular weight of 759.96 g/mol. Its IUPAC name is 2,7-bis(3,5-dimethylphenyl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-4-ylphenyl]carbazole.
| Compound Name | 2,7-bis(3,5-dimethylphenyl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-4-ylphenyl]carbazole |
|---|---|
| PubChem CID | 138579172 |
| Molecular Formula | C54H41N5 |
| Molecular Weight | 759.96 g/mol |
| Exact Mass | 759.34 |
| IUPAC Name | 2,7-bis(3,5-dimethylphenyl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-4-ylphenyl]carbazole |
| SMILES | Cc1cc(C)cc(-c2ccc3c4ccc(-c5cc(C)cc(C)c5)cc4n(-c4ccc(-c5ccncc5)cc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)c1 |
| InChI | InChI=1S/C54H41N5/c1-34-25-35(2)28-44(27-34)42-15-18-46-47-19-16-43(45-29-36(3)26-37(4)30-45)33-51(47)59(50(46)32-42)49-20-17-41(38-21-23-55-24-22-38)31-48(49)54-57-52(39-11-7-5-8-12-39)56-53(58-54)40-13-9-6-10-14-40/h5-33H,1-4H3 |
| InChIKey | VZCLDQLKYRRGEY-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.96 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |